About 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene
7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene (PubChem CID 11822974) has the molecular formula C11H17IO2
and a molecular weight of 308.16 g/mol. Its IUPAC name is 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene.
Molecular Properties
| Compound Name | 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene |
| PubChem CID | 11822974 |
| Molecular Formula | C11H17IO2 |
| Molecular Weight | 308.16 g/mol |
| Exact Mass | 308.03 |
| IUPAC Name | 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene |
| SMILES | CC1=C(I)C(C)(C)C2(CC1)OCCO2 |
| InChI | InChI=1S/C11H17IO2/c1-8-4-5-11(13-6-7-14-11)10(2,3)9(8)12/h4-7H2,1-3H3 |
| InChIKey | LORPAOZLAQIUFI-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.16 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene?
The IUPAC name of 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene (CID 11822974) is 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene.
What is the SMILES notation for 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene?
The canonical SMILES for 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene is CC1=C(I)C(C)(C)C2(CC1)OCCO2.
What is the InChIKey of 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene?
The InChIKey is LORPAOZLAQIUFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17IO2/c1-8-4-5-11(13-6-7-14-11)10(2,3)9(8)12/h4-7H2,1-3H3.
What are the key properties of 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene?
7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene has a molecular weight of 308.16 g/mol, XLogP of 3.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-iodo-6,6,8-trimethyl-1,4-dioxaspiro[4.5]dec-7-ene is sourced from PubChem (CID 11822974), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).