C6H10O — CID 118229883
1,2,2,5,5-pentadeuteriocyclopentane-1-carbaldehyde (PubChem CID 118229883) has the molecular formula C6H10O and a molecular weight of 103.18 g/mol. Its IUPAC name is 1,2,2,5,5-pentadeuteriocyclopentane-1-carbaldehyde.
| Compound Name | 1,2,2,5,5-pentadeuteriocyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 118229883 |
| Molecular Formula | C6H10O |
| Molecular Weight | 103.18 g/mol |
| Exact Mass | 103.10 |
| IUPAC Name | 1,2,2,5,5-pentadeuteriocyclopentane-1-carbaldehyde |
| SMILES | [2H]C1([2H])CCC([2H])([2H])C1([2H])C=O |
| InChI | InChI=1S/C6H10O/c7-5-6-3-1-2-4-6/h5-6H,1-4H2/i3D2,4D2,6D |
| InChIKey | VELDYOPRLMJFIK-JMFBVLFLSA-N |
| XLogP | 1.38 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 103.18 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|