About 1,7,7-trimethylazepan-3-ol
1,7,7-trimethylazepan-3-ol (PubChem CID 118230264) has the molecular formula C9H19NO
and a molecular weight of 157.26 g/mol. Its IUPAC name is 1,7,7-trimethylazepan-3-ol.
Molecular Properties
| Compound Name | 1,7,7-trimethylazepan-3-ol |
| PubChem CID | 118230264 |
| Molecular Formula | C9H19NO |
| Molecular Weight | 157.26 g/mol |
| Exact Mass | 157.15 |
| IUPAC Name | 1,7,7-trimethylazepan-3-ol |
| SMILES | CN1CC(O)CCCC1(C)C |
| InChI | InChI=1S/C9H19NO/c1-9(2)6-4-5-8(11)7-10(9)3/h8,11H,4-7H2,1-3H3 |
| InChIKey | HXTVSKIOAWOQBR-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.26 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,7,7-trimethylazepan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,7,7-trimethylazepan-3-ol?
The IUPAC name of 1,7,7-trimethylazepan-3-ol (CID 118230264) is 1,7,7-trimethylazepan-3-ol.
What is the SMILES notation for 1,7,7-trimethylazepan-3-ol?
The canonical SMILES for 1,7,7-trimethylazepan-3-ol is CN1CC(O)CCCC1(C)C.
What is the InChIKey of 1,7,7-trimethylazepan-3-ol?
The InChIKey is HXTVSKIOAWOQBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO/c1-9(2)6-4-5-8(11)7-10(9)3/h8,11H,4-7H2,1-3H3.
What are the key properties of 1,7,7-trimethylazepan-3-ol?
1,7,7-trimethylazepan-3-ol has a molecular weight of 157.26 g/mol, XLogP of 1.24, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,7,7-trimethylazepan-3-ol is sourced from PubChem (CID 118230264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).