C16H20ClNO3 — CID 11823033
1-[(2R)-4-(4-chlorophenoxy)butan-2-yl]-4-methylpiperidine-2,6-dione (PubChem CID 11823033) has the molecular formula C16H20ClNO3 and a molecular weight of 309.79 g/mol. Its IUPAC name is 1-[(2R)-4-(4-chlorophenoxy)butan-2-yl]-4-methylpiperidine-2,6-dione.
| Compound Name | 1-[(2R)-4-(4-chlorophenoxy)butan-2-yl]-4-methylpiperidine-2,6-dione |
|---|---|
| PubChem CID | 11823033 |
| Molecular Formula | C16H20ClNO3 |
| Molecular Weight | 309.79 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 1-[(2R)-4-(4-chlorophenoxy)butan-2-yl]-4-methylpiperidine-2,6-dione |
| SMILES | CC1CC(=O)N([C@H](C)CCOc2ccc(Cl)cc2)C(=O)C1 |
| InChI | InChI=1S/C16H20ClNO3/c1-11-9-15(19)18(16(20)10-11)12(2)7-8-21-14-5-3-13(17)4-6-14/h3-6,11-12H,7-10H2,1-2H3/t12-/m1/s1 |
| InChIKey | VXXSTPZFOMOQLS-GFCCVEGCSA-N |
| XLogP | 3.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.79 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|