C11H19NO4 — CID 118230401
tert-butyl (3R,6R)-3,6-dihydroxy-2,3,6,7-tetrahydroazepine-1-carboxylate (PubChem CID 118230401) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is tert-butyl (3R,6R)-3,6-dihydroxy-2,3,6,7-tetrahydroazepine-1-carboxylate.
| Compound Name | tert-butyl (3R,6R)-3,6-dihydroxy-2,3,6,7-tetrahydroazepine-1-carboxylate |
|---|---|
| PubChem CID | 118230401 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | tert-butyl (3R,6R)-3,6-dihydroxy-2,3,6,7-tetrahydroazepine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)C=C[C@@H](O)C1 |
| InChI | InChI=1S/C11H19NO4/c1-11(2,3)16-10(15)12-6-8(13)4-5-9(14)7-12/h4-5,8-9,13-14H,6-7H2,1-3H3/t8-,9-/m1/s1 |
| InChIKey | LWROFLQCAATWMD-RKDXNWHRSA-N |
| XLogP | 0.52 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|