C14H22 — CID 11823060
1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene (PubChem CID 11823060) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene.
| Compound Name | 1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
|---|---|
| PubChem CID | 11823060 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 1,3,3-trimethyl-2-[(1E)-3-methylbuta-1,3-dienyl]cyclohexene |
| SMILES | C=C(C)/C=C/C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C14H22/c1-11(2)8-9-13-12(3)7-6-10-14(13,4)5/h8-9H,1,6-7,10H2,2-5H3/b9-8+ |
| InChIKey | HBWDSNQPXWSPEL-CMDGGOBGSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|