C12H23N3O5S — CID 118230782
1-methyl-3-(2-methylpropyl)-1-[[(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexylidene]amino]thiourea (PubChem CID 118230782) has the molecular formula C12H23N3O5S and a molecular weight of 321.40 g/mol. Its IUPAC name is 1-methyl-3-(2-methylpropyl)-1-[[(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexylidene]amino]thiourea.
| Compound Name | 1-methyl-3-(2-methylpropyl)-1-[[(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexylidene]amino]thiourea |
|---|---|
| PubChem CID | 118230782 |
| Molecular Formula | C12H23N3O5S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | 1-methyl-3-(2-methylpropyl)-1-[[(2R,3R,5R,6S)-2,3,4,5,6-pentahydroxycyclohexylidene]amino]thiourea |
| SMILES | CC(C)CNC(=S)N(C)/N=C1\[C@@H](O)[C@@H](O)C(O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23N3O5S/c1-5(2)4-13-12(21)15(3)14-6-7(16)9(18)11(20)10(19)8(6)17/h5,7-11,16-20H,4H2,1-3H3,(H,13,21)/b14-6-/t7-,8+,9+,10+,11?/m0/s1 |
| InChIKey | NPNZWUMCYGVQOP-JNLSNFFLSA-N |
| XLogP | -2.38 |
| TPSA | 128.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|