About 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde
2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde (PubChem CID 11823083) has the molecular formula C13H13IO
and a molecular weight of 312.15 g/mol. Its IUPAC name is 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde.
Molecular Properties
| Compound Name | 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde |
| PubChem CID | 11823083 |
| Molecular Formula | C13H13IO |
| Molecular Weight | 312.15 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde |
| SMILES | O=CC1=C(C#CCCCC#CI)CCC1 |
| InChI | InChI=1S/C13H13IO/c14-10-5-3-1-2-4-7-12-8-6-9-13(12)11-15/h11H,1-3,6,8-9H2 |
| InChIKey | VDBHBBHIBLVEFK-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.15 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde?
The IUPAC name of 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde (CID 11823083) is 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde.
What is the SMILES notation for 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde?
The canonical SMILES for 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde is O=CC1=C(C#CCCCC#CI)CCC1.
What is the InChIKey of 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde?
The InChIKey is VDBHBBHIBLVEFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13IO/c14-10-5-3-1-2-4-7-12-8-6-9-13(12)11-15/h11H,1-3,6,8-9H2.
What are the key properties of 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde?
2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde has a molecular weight of 312.15 g/mol, XLogP of 3.24, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(7-iodohepta-1,6-diynyl)cyclopentene-1-carbaldehyde is sourced from PubChem (CID 11823083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).