C32H26BrN5O4 — CID 118231040
7-bromo-6-[[3,7-dihydroxy-1-(2-phenylethyl)-3,4-dihydro-2H-benzo[h]quinolin-6-yl]diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile (PubChem CID 118231040) has the molecular formula C32H26BrN5O4 and a molecular weight of 624.50 g/mol. Its IUPAC name is 7-bromo-6-[[3,7-dihydroxy-1-(2-phenylethyl)-3,4-dihydro-2H-benzo[h]quinolin-6-yl]diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile.
| Compound Name | 7-bromo-6-[[3,7-dihydroxy-1-(2-phenylethyl)-3,4-dihydro-2H-benzo[h]quinolin-6-yl]diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 118231040 |
| Molecular Formula | C32H26BrN5O4 |
| Molecular Weight | 624.50 g/mol |
| Exact Mass | 623.12 |
| IUPAC Name | 7-bromo-6-[[3,7-dihydroxy-1-(2-phenylethyl)-3,4-dihydro-2H-benzo[h]quinolin-6-yl]diazenyl]-2-ethyl-1,3-dioxoisoindole-5-carbonitrile |
| SMILES | CCN1C(=O)c2cc(C#N)c(/N=N/c3cc4c(c5cccc(O)c35)N(CCc3ccccc3)CC(O)C4)c(Br)c2C1=O |
| InChI | InChI=1S/C32H26BrN5O4/c1-2-38-31(41)23-14-20(16-34)29(28(33)27(23)32(38)42)36-35-24-15-19-13-21(39)17-37(12-11-18-7-4-3-5-8-18)30(19)22-9-6-10-25(40)26(22)24/h3-10,14-15,21,39-40H,2,11-13,17H2,1H3/b36-35+ |
| InChIKey | KKMKOTUQUFGQCH-ULDVOPSXSA-N |
| XLogP | 6.18 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.50 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|