C23H22BrN5O3 — CID 118231059
7-bromo-2-ethyl-6-[[1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3-dioxoisoindole-5-carbonitrile (PubChem CID 118231059) has the molecular formula C23H22BrN5O3 and a molecular weight of 496.37 g/mol. Its IUPAC name is 7-bromo-2-ethyl-6-[[1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3-dioxoisoindole-5-carbonitrile.
| Compound Name | 7-bromo-2-ethyl-6-[[1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3-dioxoisoindole-5-carbonitrile |
|---|---|
| PubChem CID | 118231059 |
| Molecular Formula | C23H22BrN5O3 |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 495.09 |
| IUPAC Name | 7-bromo-2-ethyl-6-[[1-(2-methoxyethyl)-3,4-dihydro-2H-quinolin-6-yl]diazenyl]-1,3-dioxoisoindole-5-carbonitrile |
| SMILES | CCN1C(=O)c2cc(C#N)c(/N=N/c3ccc4c(c3)CCCN4CCOC)c(Br)c2C1=O |
| InChI | InChI=1S/C23H22BrN5O3/c1-3-29-22(30)17-12-15(13-25)21(20(24)19(17)23(29)31)27-26-16-6-7-18-14(11-16)5-4-8-28(18)9-10-32-2/h6-7,11-12H,3-5,8-10H2,1-2H3/b27-26+ |
| InChIKey | FPGVVNZEVTYJCJ-CYYJNZCTSA-N |
| XLogP | 4.75 |
| TPSA | 98.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|