C11H11FO4 — CID 118231092
4-fluoro-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid (PubChem CID 118231092) has the molecular formula C11H11FO4 and a molecular weight of 226.20 g/mol. Its IUPAC name is 4-fluoro-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid.
| Compound Name | 4-fluoro-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 118231092 |
| Molecular Formula | C11H11FO4 |
| Molecular Weight | 226.20 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 4-fluoro-11,12-dioxatetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
| SMILES | O=C(O)C1(F)CC2OC1C1C3C=CC(O3)C21 |
| InChI | InChI=1S/C11H11FO4/c12-11(10(13)14)3-6-7-4-1-2-5(15-4)8(7)9(11)16-6/h1-2,4-9H,3H2,(H,13,14) |
| InChIKey | MVTJBTOAFZHSSA-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.20 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|