About 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole
6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole (PubChem CID 118231275) has the molecular formula C19H21N
and a molecular weight of 263.38 g/mol. Its IUPAC name is 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole |
| PubChem CID | 118231275 |
| Molecular Formula | C19H21N |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole |
| SMILES | CCN1CCc2ccc(-c3ccc4c(c3)CCC4)cc21 |
| InChI | InChI=1S/C19H21N/c1-2-20-11-10-15-7-9-18(13-19(15)20)17-8-6-14-4-3-5-16(14)12-17/h6-9,12-13H,2-5,10-11H2,1H3 |
| InChIKey | GQKREEBSYRLPPC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole?
The IUPAC name of 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole (CID 118231275) is 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole.
What is the SMILES notation for 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole?
The canonical SMILES for 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole is CCN1CCc2ccc(-c3ccc4c(c3)CCC4)cc21.
What is the InChIKey of 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole?
The InChIKey is GQKREEBSYRLPPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N/c1-2-20-11-10-15-7-9-18(13-19(15)20)17-8-6-14-4-3-5-16(14)12-17/h6-9,12-13H,2-5,10-11H2,1H3.
What are the key properties of 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole?
6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole has a molecular weight of 263.38 g/mol, XLogP of 4.22, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,3-dihydro-1H-inden-5-yl)-1-ethyl-2,3-dihydroindole is sourced from PubChem (CID 118231275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).