C13H13BrO2S — CID 11823133
(1R,5R,7S)-4-bromo-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]oct-2-ene (PubChem CID 11823133) has the molecular formula C13H13BrO2S and a molecular weight of 313.22 g/mol. Its IUPAC name is (1R,5R,7S)-4-bromo-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]oct-2-ene.
| Compound Name | (1R,5R,7S)-4-bromo-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]oct-2-ene |
|---|---|
| PubChem CID | 11823133 |
| Molecular Formula | C13H13BrO2S |
| Molecular Weight | 313.22 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | (1R,5R,7S)-4-bromo-7-(phenylsulfanylmethyl)-6,8-dioxabicyclo[3.2.1]oct-2-ene |
| SMILES | BrC1C=C[C@H]2O[C@@H]1O[C@@H]2CSc1ccccc1 |
| InChI | InChI=1S/C13H13BrO2S/c14-10-6-7-11-12(16-13(10)15-11)8-17-9-4-2-1-3-5-9/h1-7,10-13H,8H2/t10?,11-,12-,13-/m1/s1 |
| InChIKey | KTENPEYXOCBVAV-KIGPFUIMSA-N |
| XLogP | 3.22 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.22 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|