About 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine
1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine (PubChem CID 118231389) has the molecular formula C12H25N3
and a molecular weight of 211.35 g/mol. Its IUPAC name is 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine.
Molecular Properties
| Compound Name | 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine |
| PubChem CID | 118231389 |
| Molecular Formula | C12H25N3 |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.20 |
| IUPAC Name | 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine |
| SMILES | C=C(N)N(C)C1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C12H25N3/c1-10(13)14(5)11-6-8-15(9-7-11)12(2,3)4/h11H,1,6-9,13H2,2-5H3 |
| InChIKey | FDRYGLHSAADLMA-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine?
The IUPAC name of 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine (CID 118231389) is 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine.
What is the SMILES notation for 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine?
The canonical SMILES for 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine is C=C(N)N(C)C1CCN(C(C)(C)C)CC1.
What is the InChIKey of 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine?
The InChIKey is FDRYGLHSAADLMA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3/c1-10(13)14(5)11-6-8-15(9-7-11)12(2,3)4/h11H,1,6-9,13H2,2-5H3.
What are the key properties of 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine?
1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine has a molecular weight of 211.35 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N'-(1-tert-butylpiperidin-4-yl)-1-N'-methylethene-1,1-diamine is sourced from PubChem (CID 118231389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).