C28H25N3O3 — CID 118231558
(4E)-4-[hydroxy(pyridin-3-yl)methylidene]-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-5-(4-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 118231558) has the molecular formula C28H25N3O3 and a molecular weight of 451.53 g/mol. Its IUPAC name is (4E)-4-[hydroxy(pyridin-3-yl)methylidene]-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-5-(4-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[hydroxy(pyridin-3-yl)methylidene]-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 118231558 |
| Molecular Formula | C28H25N3O3 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.19 |
| IUPAC Name | (4E)-4-[hydroxy(pyridin-3-yl)methylidene]-1-[2-(6-methyl-1H-indol-3-yl)ethyl]-5-(4-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1ccc(C2/C(=C(\O)c3cccnc3)C(=O)C(=O)N2CCc2c[nH]c3cc(C)ccc23)cc1 |
| InChI | InChI=1S/C28H25N3O3/c1-17-5-8-19(9-6-17)25-24(26(32)21-4-3-12-29-15-21)27(33)28(34)31(25)13-11-20-16-30-23-14-18(2)7-10-22(20)23/h3-10,12,14-16,25,30,32H,11,13H2,1-2H3/b26-24+ |
| InChIKey | XOVJDTGKFQPHGL-SHHOIMCASA-N |
| XLogP | 4.84 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|