C12H14F4O8S — CID 118231716
1,1,2,2-tetrafluoro-4-[2-(5-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonic acid (PubChem CID 118231716) has the molecular formula C12H14F4O8S and a molecular weight of 394.30 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-4-[2-(5-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonic acid.
| Compound Name | 1,1,2,2-tetrafluoro-4-[2-(5-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 118231716 |
| Molecular Formula | C12H14F4O8S |
| Molecular Weight | 394.30 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | 1,1,2,2-tetrafluoro-4-[2-(5-oxooxolan-3-yl)oxycarbonylprop-2-enoxy]butane-1-sulfonic acid |
| SMILES | C=C(COCCC(F)(F)C(F)(F)S(=O)(=O)O)C(=O)OC1COC(=O)C1 |
| InChI | InChI=1S/C12H14F4O8S/c1-7(10(18)24-8-4-9(17)23-6-8)5-22-3-2-11(13,14)12(15,16)25(19,20)21/h8H,1-6H2,(H,19,20,21) |
| InChIKey | PJLCAEHOXMPUQM-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.30 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|