C28H25Cl2N3O4 — CID 118232118
N-[2-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-2-oxo-1,6-naphthyridin-7-yl]phenyl]-N-methylprop-2-enamide (PubChem CID 118232118) has the molecular formula C28H25Cl2N3O4 and a molecular weight of 538.43 g/mol. Its IUPAC name is N-[2-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-2-oxo-1,6-naphthyridin-7-yl]phenyl]-N-methylprop-2-enamide.
| Compound Name | N-[2-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-2-oxo-1,6-naphthyridin-7-yl]phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 118232118 |
| Molecular Formula | C28H25Cl2N3O4 |
| Molecular Weight | 538.43 g/mol |
| Exact Mass | 537.12 |
| IUPAC Name | N-[2-[3-(2,6-dichloro-3,5-dimethoxyphenyl)-1-ethyl-2-oxo-1,6-naphthyridin-7-yl]phenyl]-N-methylprop-2-enamide |
| SMILES | C=CC(=O)N(C)c1ccccc1-c1cc2c(cn1)cc(-c1c(Cl)c(OC)cc(OC)c1Cl)c(=O)n2CC |
| InChI | InChI=1S/C28H25Cl2N3O4/c1-6-24(34)32(3)20-11-9-8-10-17(20)19-13-21-16(15-31-19)12-18(28(35)33(21)7-2)25-26(29)22(36-4)14-23(37-5)27(25)30/h6,8-15H,1,7H2,2-5H3 |
| InChIKey | XFSZPZSBCWMYLJ-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 73.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.43 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|