About 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene
6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene (PubChem CID 118232211) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene.
Molecular Properties
| Compound Name | 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene |
| PubChem CID | 118232211 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene |
| SMILES | CC1=C(C)N2CCCN1CC2 |
| InChI | InChI=1S/C9H16N2/c1-8-9(2)11-5-3-4-10(8)6-7-11/h3-7H2,1-2H3 |
| InChIKey | LSFXYKWCTLVRFP-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene?
The IUPAC name of 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene (CID 118232211) is 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene.
What is the SMILES notation for 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene?
The canonical SMILES for 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene is CC1=C(C)N2CCCN1CC2.
What is the InChIKey of 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene?
The InChIKey is LSFXYKWCTLVRFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-8-9(2)11-5-3-4-10(8)6-7-11/h3-7H2,1-2H3.
What are the key properties of 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene?
6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene has a molecular weight of 152.24 g/mol, XLogP of 1.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethyl-1,5-diazabicyclo[3.2.2]non-6-ene is sourced from PubChem (CID 118232211), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).