C26H29FN2O3S — CID 118232488
(E)-3-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]prop-2-enenitrile (PubChem CID 118232488) has the molecular formula C26H29FN2O3S and a molecular weight of 468.59 g/mol. Its IUPAC name is (E)-3-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]prop-2-enenitrile.
| Compound Name | (E)-3-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 118232488 |
| Molecular Formula | C26H29FN2O3S |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.19 |
| IUPAC Name | (E)-3-[4-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]oxan-4-yl]prop-2-enenitrile |
| SMILES | C[C@H]1CC[C@H](c2ccccc2)S(=O)(=O)N1Cc1ccc(C2(/C=C/C#N)CCOCC2)cc1F |
| InChI | InChI=1S/C26H29FN2O3S/c1-20-8-11-25(21-6-3-2-4-7-21)33(30,31)29(20)19-22-9-10-23(18-24(22)27)26(12-5-15-28)13-16-32-17-14-26/h2-7,9-10,12,18,20,25H,8,11,13-14,16-17,19H2,1H3/b12-5+/t20-,25+/m0/s1 |
| InChIKey | NLMRUQQZLANWTO-VEVHBFNKSA-N |
| XLogP | 5.01 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|