C28H34FN5O3S — CID 118232551
1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-methyl-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide (PubChem CID 118232551) has the molecular formula C28H34FN5O3S and a molecular weight of 539.68 g/mol. Its IUPAC name is 1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-methyl-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide.
| Compound Name | 1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-methyl-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 118232551 |
| Molecular Formula | C28H34FN5O3S |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | 1-[3-fluoro-4-[[(3S,6R)-3-methyl-1,1-dioxo-6-phenylthiazinan-2-yl]methyl]phenyl]-N-methyl-4-(1,2,4-triazol-4-yl)cyclohexane-1-carboxamide |
| SMILES | CNC(=O)C1(c2ccc(CN3[C@@H](C)CC[C@H](c4ccccc4)S3(=O)=O)c(F)c2)CCC(n2cnnc2)CC1 |
| InChI | InChI=1S/C28H34FN5O3S/c1-20-8-11-26(21-6-4-3-5-7-21)38(36,37)34(20)17-22-9-10-23(16-25(22)29)28(27(35)30-2)14-12-24(13-15-28)33-18-31-32-19-33/h3-7,9-10,16,18-20,24,26H,8,11-15,17H2,1-2H3,(H,30,35)/t20-,24?,26+,28?/m0/s1 |
| InChIKey | ONNWZXLUPBBMFJ-WQCKDBBGSA-N |
| XLogP | 4.27 |
| TPSA | 97.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |