C15H26O7 — CID 11823300
(2S,3S,5R,6R)-5,6-dimethoxy-3-[(1R)-1-(methoxymethoxy)but-3-enyl]-5,6-dimethyl-1,4-dioxane-2-carbaldehyde (PubChem CID 11823300) has the molecular formula C15H26O7 and a molecular weight of 318.37 g/mol. Its IUPAC name is (2S,3S,5R,6R)-5,6-dimethoxy-3-[(1R)-1-(methoxymethoxy)but-3-enyl]-5,6-dimethyl-1,4-dioxane-2-carbaldehyde.
| Compound Name | (2S,3S,5R,6R)-5,6-dimethoxy-3-[(1R)-1-(methoxymethoxy)but-3-enyl]-5,6-dimethyl-1,4-dioxane-2-carbaldehyde |
|---|---|
| PubChem CID | 11823300 |
| Molecular Formula | C15H26O7 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (2S,3S,5R,6R)-5,6-dimethoxy-3-[(1R)-1-(methoxymethoxy)but-3-enyl]-5,6-dimethyl-1,4-dioxane-2-carbaldehyde |
| SMILES | C=CC[C@@H](OCOC)[C@@H]1O[C@@](C)(OC)[C@](C)(OC)O[C@@H]1C=O |
| InChI | InChI=1S/C15H26O7/c1-7-8-11(20-10-17-4)13-12(9-16)21-14(2,18-5)15(3,19-6)22-13/h7,9,11-13H,1,8,10H2,2-6H3/t11-,12-,13+,14-,15-/m1/s1 |
| InChIKey | DACWJZHHJWOINZ-UXXRCYHCSA-N |
| XLogP | 1.26 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|