C20H30O3 — CID 11823304
(1S)-2-(furan-3-yl)-1-[(1R,6S,9S,12S)-5,5,9-trimethyl-10-oxatricyclo[7.2.1.01,6]dodecan-12-yl]ethanol (PubChem CID 11823304) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (1S)-2-(furan-3-yl)-1-[(1R,6S,9S,12S)-5,5,9-trimethyl-10-oxatricyclo[7.2.1.01,6]dodecan-12-yl]ethanol.
| Compound Name | (1S)-2-(furan-3-yl)-1-[(1R,6S,9S,12S)-5,5,9-trimethyl-10-oxatricyclo[7.2.1.01,6]dodecan-12-yl]ethanol |
|---|---|
| PubChem CID | 11823304 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (1S)-2-(furan-3-yl)-1-[(1R,6S,9S,12S)-5,5,9-trimethyl-10-oxatricyclo[7.2.1.01,6]dodecan-12-yl]ethanol |
| SMILES | CC1(C)CCC[C@@]23CO[C@@](C)(CC[C@@H]12)[C@@H]3[C@@H](O)Cc1ccoc1 |
| InChI | InChI=1S/C20H30O3/c1-18(2)7-4-8-20-13-23-19(3,9-5-16(18)20)17(20)15(21)11-14-6-10-22-12-14/h6,10,12,15-17,21H,4-5,7-9,11,13H2,1-3H3/t15-,16-,17-,19-,20+/m0/s1 |
| InChIKey | HHLVVSUTGBWSQY-VDWQKOAOSA-N |
| XLogP | 4.19 |
| TPSA | 42.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |