C12H24ClN5O3 — CID 118233347
1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-chloropiperazine (PubChem CID 118233347) has the molecular formula C12H24ClN5O3 and a molecular weight of 321.81 g/mol. Its IUPAC name is 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-chloropiperazine.
| Compound Name | 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-chloropiperazine |
|---|---|
| PubChem CID | 118233347 |
| Molecular Formula | C12H24ClN5O3 |
| Molecular Weight | 321.81 g/mol |
| Exact Mass | 321.16 |
| IUPAC Name | 1-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethyl]-4-chloropiperazine |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCN1CCN(Cl)CC1 |
| InChI | InChI=1S/C12H24ClN5O3/c13-18-4-2-17(3-5-18)6-8-20-10-12-21-11-9-19-7-1-15-16-14/h1-12H2 |
| InChIKey | VLTFCCZZHICXSW-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 82.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.81 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|