C16H21FO2 — CID 118233701
4-(fluoromethyl)-5,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid (PubChem CID 118233701) has the molecular formula C16H21FO2 and a molecular weight of 264.34 g/mol. Its IUPAC name is 4-(fluoromethyl)-5,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid.
| Compound Name | 4-(fluoromethyl)-5,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
|---|---|
| PubChem CID | 118233701 |
| Molecular Formula | C16H21FO2 |
| Molecular Weight | 264.34 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | 4-(fluoromethyl)-5,5-dimethyltetracyclo[6.2.1.13,6.02,7]dodec-9-ene-4-carboxylic acid |
| SMILES | CC1(C)C2CC(C3C4C=CC(C4)C32)C1(CF)C(=O)O |
| InChI | InChI=1S/C16H21FO2/c1-15(2)10-6-11(16(15,7-17)14(18)19)13-9-4-3-8(5-9)12(10)13/h3-4,8-13H,5-7H2,1-2H3,(H,18,19) |
| InChIKey | YQLQGAKUFIIUOR-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|