About 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride
4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride (PubChem CID 118233757) has the molecular formula C7H8F2O2S
and a molecular weight of 194.20 g/mol. Its IUPAC name is 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride.
Molecular Properties
| Compound Name | 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride |
| PubChem CID | 118233757 |
| Molecular Formula | C7H8F2O2S |
| Molecular Weight | 194.20 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride |
| SMILES | CC1CC(S(=O)(=O)F)=CC=C1F |
| InChI | InChI=1S/C7H8F2O2S/c1-5-4-6(12(9,10)11)2-3-7(5)8/h2-3,5H,4H2,1H3 |
| InChIKey | XRVBNCYZJUYBAR-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.20 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride?
The IUPAC name of 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride (CID 118233757) is 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride.
What is the SMILES notation for 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride?
The canonical SMILES for 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride is CC1CC(S(=O)(=O)F)=CC=C1F.
What is the InChIKey of 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride?
The InChIKey is XRVBNCYZJUYBAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2O2S/c1-5-4-6(12(9,10)11)2-3-7(5)8/h2-3,5H,4H2,1H3.
What are the key properties of 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride?
4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride has a molecular weight of 194.20 g/mol, XLogP of 2.06, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-5-methylcyclohexa-1,3-diene-1-sulfonyl fluoride is sourced from PubChem (CID 118233757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).