C16H8Cl2N2O — CID 118233853
2-chloro-4-(3-chlorophenyl)-[1]benzofuro[3,2-d]pyrimidine (PubChem CID 118233853) has the molecular formula C16H8Cl2N2O and a molecular weight of 315.16 g/mol. Its IUPAC name is 2-chloro-4-(3-chlorophenyl)-[1]benzofuro[3,2-d]pyrimidine.
| Compound Name | 2-chloro-4-(3-chlorophenyl)-[1]benzofuro[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 118233853 |
| Molecular Formula | C16H8Cl2N2O |
| Molecular Weight | 315.16 g/mol |
| Exact Mass | 314.00 |
| IUPAC Name | 2-chloro-4-(3-chlorophenyl)-[1]benzofuro[3,2-d]pyrimidine |
| SMILES | Clc1cccc(-c2nc(Cl)nc3c2oc2ccccc23)c1 |
| InChI | InChI=1S/C16H8Cl2N2O/c17-10-5-3-4-9(8-10)13-15-14(20-16(18)19-13)11-6-1-2-7-12(11)21-15/h1-8H |
| InChIKey | BUAHWEKBSYFAMT-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.16 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |