About 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane
2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane (PubChem CID 118234178) has the molecular formula C9H16FN
and a molecular weight of 157.23 g/mol. Its IUPAC name is 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane.
Molecular Properties
| Compound Name | 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane |
| PubChem CID | 118234178 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane |
| SMILES | CC1CC2CCC(C1F)N2C |
| InChI | InChI=1S/C9H16FN/c1-6-5-7-3-4-8(9(6)10)11(7)2/h6-9H,3-5H2,1-2H3 |
| InChIKey | BVSYGROBGCQTPM-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane?
The IUPAC name of 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane (CID 118234178) is 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane.
What is the SMILES notation for 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane?
The canonical SMILES for 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane is CC1CC2CCC(C1F)N2C.
What is the InChIKey of 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane?
The InChIKey is BVSYGROBGCQTPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16FN/c1-6-5-7-3-4-8(9(6)10)11(7)2/h6-9H,3-5H2,1-2H3.
What are the key properties of 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane?
2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane has a molecular weight of 157.23 g/mol, XLogP of 1.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-3,8-dimethyl-8-azabicyclo[3.2.1]octane is sourced from PubChem (CID 118234178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).