About (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol
(4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol (PubChem CID 118234295) has the molecular formula C9H12F6O2
and a molecular weight of 266.18 g/mol. Its IUPAC name is (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol.
Molecular Properties
| Compound Name | (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol |
| PubChem CID | 118234295 |
| Molecular Formula | C9H12F6O2 |
| Molecular Weight | 266.18 g/mol |
| Exact Mass | 266.07 |
| IUPAC Name | (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol |
| SMILES | C[C@H]1CC(C)(C(F)(F)F)OC(O)(C(F)(F)F)C1 |
| InChI | InChI=1S/C9H12F6O2/c1-5-3-6(2,8(10,11)12)17-7(16,4-5)9(13,14)15/h5,16H,3-4H2,1-2H3/t5-,6?,7?/m0/s1 |
| InChIKey | ZVZMVXPESWIGGT-VTSJMVTISA-N |
| XLogP | 3.00 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.18 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol?
The IUPAC name of (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol (CID 118234295) is (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol.
What is the SMILES notation for (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol?
The canonical SMILES for (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol is C[C@H]1CC(C)(C(F)(F)F)OC(O)(C(F)(F)F)C1.
What is the InChIKey of (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol?
The InChIKey is ZVZMVXPESWIGGT-VTSJMVTISA-N. The full InChI is InChI=1S/C9H12F6O2/c1-5-3-6(2,8(10,11)12)17-7(16,4-5)9(13,14)15/h5,16H,3-4H2,1-2H3/t5-,6?,7?/m0/s1.
What are the key properties of (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol?
(4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol has a molecular weight of 266.18 g/mol, XLogP of 3.00, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4,6-dimethyl-2,6-bis(trifluoromethyl)oxan-2-ol is sourced from PubChem (CID 118234295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).