About [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane
[5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane (PubChem CID 11823461) has the molecular formula C13H30OS2Si2
and a molecular weight of 322.69 g/mol. Its IUPAC name is [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane.
Molecular Properties
| Compound Name | [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane |
| PubChem CID | 11823461 |
| Molecular Formula | C13H30OS2Si2 |
| Molecular Weight | 322.69 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane |
| SMILES | C=C(C(CC(SC)SC)O[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C13H30OS2Si2/c1-11(17(4,5)6)12(14-18(7,8)9)10-13(15-2)16-3/h12-13H,1,10H2,2-9H3 |
| InChIKey | NWGAKFOPJCXYKQ-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 322.69 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane?
The IUPAC name of [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane (CID 11823461) is [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane.
What is the SMILES notation for [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane?
The canonical SMILES for [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane is C=C(C(CC(SC)SC)O[Si](C)(C)C)[Si](C)(C)C.
What is the InChIKey of [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane?
The InChIKey is NWGAKFOPJCXYKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H30OS2Si2/c1-11(17(4,5)6)12(14-18(7,8)9)10-13(15-2)16-3/h12-13H,1,10H2,2-9H3.
What are the key properties of [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane?
[5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane has a molecular weight of 322.69 g/mol, XLogP of 5.08, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [5,5-bis(methylsulfanyl)-3-trimethylsilyloxypent-1-en-2-yl]-trimethylsilane is sourced from PubChem (CID 11823461), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).