About 5-amino-2,3,4-triethylphenol
5-amino-2,3,4-triethylphenol (PubChem CID 118234827) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 5-amino-2,3,4-triethylphenol.
Molecular Properties
| Compound Name | 5-amino-2,3,4-triethylphenol |
| PubChem CID | 118234827 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 5-amino-2,3,4-triethylphenol |
| SMILES | CCc1c(N)cc(O)c(CC)c1CC |
| InChI | InChI=1S/C12H19NO/c1-4-8-9(5-2)11(13)7-12(14)10(8)6-3/h7,14H,4-6,13H2,1-3H3 |
| InChIKey | BUPXLJMDANHCNA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,3,4-triethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3,4-triethylphenol?
The IUPAC name of 5-amino-2,3,4-triethylphenol (CID 118234827) is 5-amino-2,3,4-triethylphenol.
What is the SMILES notation for 5-amino-2,3,4-triethylphenol?
The canonical SMILES for 5-amino-2,3,4-triethylphenol is CCc1c(N)cc(O)c(CC)c1CC.
What is the InChIKey of 5-amino-2,3,4-triethylphenol?
The InChIKey is BUPXLJMDANHCNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO/c1-4-8-9(5-2)11(13)7-12(14)10(8)6-3/h7,14H,4-6,13H2,1-3H3.
What are the key properties of 5-amino-2,3,4-triethylphenol?
5-amino-2,3,4-triethylphenol has a molecular weight of 193.29 g/mol, XLogP of 2.66, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3,4-triethylphenol is sourced from PubChem (CID 118234827), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).