About [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate
[1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate (PubChem CID 118234850) has the molecular formula C23H36N4O3
and a molecular weight of 416.57 g/mol. Its IUPAC name is [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate.
Molecular Properties
| Compound Name | [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate |
| PubChem CID | 118234850 |
| Molecular Formula | C23H36N4O3 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.28 |
| IUPAC Name | [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate |
| SMILES | CC(C)(C)n1ncc(OC(=O)NC2C3CC4CC(C3)CC2C4)c1N1CCC(O)CC1 |
| InChI | InChI=1S/C23H36N4O3/c1-23(2,3)27-21(26-6-4-18(28)5-7-26)19(13-24-27)30-22(29)25-20-16-9-14-8-15(11-16)12-17(20)10-14/h13-18,20,28H,4-12H2,1-3H3,(H,25,29) |
| InChIKey | KXADOWSKYFYIPX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate?
The IUPAC name of [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate (CID 118234850) is [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate.
What is the SMILES notation for [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate?
The canonical SMILES for [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate is CC(C)(C)n1ncc(OC(=O)NC2C3CC4CC(C3)CC2C4)c1N1CCC(O)CC1.
What is the InChIKey of [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate?
The InChIKey is KXADOWSKYFYIPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H36N4O3/c1-23(2,3)27-21(26-6-4-18(28)5-7-26)19(13-24-27)30-22(29)25-20-16-9-14-8-15(11-16)12-17(20)10-14/h13-18,20,28H,4-12H2,1-3H3,(H,25,29).
What are the key properties of [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate?
[1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate has a molecular weight of 416.57 g/mol, XLogP of 3.51, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1-tert-butyl-5-(4-hydroxypiperidin-1-yl)pyrazol-4-yl] N-(2-adamantyl)carbamate is sourced from PubChem (CID 118234850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).