About 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide
3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide (PubChem CID 118235005) has the molecular formula C8H14N2O3
and a molecular weight of 186.21 g/mol. Its IUPAC name is 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide.
Molecular Properties
| Compound Name | 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide |
| PubChem CID | 118235005 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide |
| SMILES | NC(=O)C(O)CNCC1C=CCO1 |
| InChI | InChI=1S/C8H14N2O3/c9-8(12)7(11)5-10-4-6-2-1-3-13-6/h1-2,6-7,10-11H,3-5H2,(H2,9,12) |
| InChIKey | KSZZEGLUOPXJHA-UHFFFAOYSA-N |
| XLogP | -1.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide?
The IUPAC name of 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide (CID 118235005) is 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide.
What is the SMILES notation for 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide?
The canonical SMILES for 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide is NC(=O)C(O)CNCC1C=CCO1.
What is the InChIKey of 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide?
The InChIKey is KSZZEGLUOPXJHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2O3/c9-8(12)7(11)5-10-4-6-2-1-3-13-6/h1-2,6-7,10-11H,3-5H2,(H2,9,12).
What are the key properties of 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide?
3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide has a molecular weight of 186.21 g/mol, XLogP of -1.62, 5 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,5-dihydrofuran-2-ylmethylamino)-2-hydroxypropanamide is sourced from PubChem (CID 118235005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).