C22H30O2 — CID 11823591
3,4-bis(non-4-ynyl)cyclobut-3-ene-1,2-dione (PubChem CID 11823591) has the molecular formula C22H30O2 and a molecular weight of 326.48 g/mol. Its IUPAC name is 3,4-bis(non-4-ynyl)cyclobut-3-ene-1,2-dione.
| Compound Name | 3,4-bis(non-4-ynyl)cyclobut-3-ene-1,2-dione |
|---|---|
| PubChem CID | 11823591 |
| Molecular Formula | C22H30O2 |
| Molecular Weight | 326.48 g/mol |
| Exact Mass | 326.22 |
| IUPAC Name | 3,4-bis(non-4-ynyl)cyclobut-3-ene-1,2-dione |
| SMILES | CCCCC#CCCCc1c(CCCC#CCCCC)c(=O)c1=O |
| InChI | InChI=1S/C22H30O2/c1-3-5-7-9-11-13-15-17-19-20(22(24)21(19)23)18-16-14-12-10-8-6-4-2/h3-8,13-18H2,1-2H3 |
| InChIKey | SHWNVSVXFXEPMP-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.48 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|