About 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole
4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole (PubChem CID 118235998) has the molecular formula C16H17ClN6O2S
and a molecular weight of 392.87 g/mol. Its IUPAC name is 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole.
Molecular Properties
| Compound Name | 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole |
| PubChem CID | 118235998 |
| Molecular Formula | C16H17ClN6O2S |
| Molecular Weight | 392.87 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole |
| SMILES | Cc1ccc(-c2c(Cl)nc(C#N)n2S(=O)(=O)N(C)C)cc1.c1c[nH]cn1 |
| InChI | InChI=1S/C13H13ClN4O2S.C3H4N2/c1-9-4-6-10(7-5-9)12-13(14)16-11(8-15)18(12)21(19,20)17(2)3;1-2-5-3-4-1/h4-7H,1-3H3;1-3H,(H,4,5) |
| InChIKey | LMZVZJSJYOFJAC-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 107.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.87 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole?
The IUPAC name of 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole (CID 118235998) is 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole.
What is the SMILES notation for 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole?
The canonical SMILES for 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole is Cc1ccc(-c2c(Cl)nc(C#N)n2S(=O)(=O)N(C)C)cc1.c1c[nH]cn1.
What is the InChIKey of 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole?
The InChIKey is LMZVZJSJYOFJAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13ClN4O2S.C3H4N2/c1-9-4-6-10(7-5-9)12-13(14)16-11(8-15)18(12)21(19,20)17(2)3;1-2-5-3-4-1/h4-7H,1-3H3;1-3H,(H,4,5).
What are the key properties of 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole?
4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole has a molecular weight of 392.87 g/mol, XLogP of 2.45, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2-cyano-N,N-dimethyl-5-(4-methylphenyl)imidazole-1-sulfonamide;1H-imidazole is sourced from PubChem (CID 118235998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).