C30H25ClF2N4O2S — CID 118236076
(10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-isothiocyanato-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one (PubChem CID 118236076) has the molecular formula C30H25ClF2N4O2S and a molecular weight of 579.07 g/mol. Its IUPAC name is (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-isothiocyanato-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one.
| Compound Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-isothiocyanato-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
|---|---|
| PubChem CID | 118236076 |
| Molecular Formula | C30H25ClF2N4O2S |
| Molecular Weight | 579.07 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (10R,14S)-14-[4-(3-chloro-2,6-difluorophenyl)-6-oxo-2,3-dihydropyridin-1-yl]-5-isothiocyanato-10-methyl-8,16-diazatricyclo[13.3.1.02,7]nonadeca-1(19),2(7),3,5,15,17-hexaen-9-one |
| SMILES | C[C@@H]1CCC[C@H](N2CCC(c3c(F)ccc(Cl)c3F)=CC2=O)c2cc(ccn2)-c2ccc(N=C=S)cc2NC1=O |
| InChI | InChI=1S/C30H25ClF2N4O2S/c1-17-3-2-4-26(37-12-10-19(14-27(37)38)28-23(32)8-7-22(31)29(28)33)25-13-18(9-11-34-25)21-6-5-20(35-16-40)15-24(21)36-30(17)39/h5-9,11,13-15,17,26H,2-4,10,12H2,1H3,(H,36,39)/t17-,26+/m1/s1 |
| InChIKey | OUTHEJXQFFWBRD-QUGAMOGWSA-N |
| XLogP | 7.53 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.07 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|