About 9-diazo-9aH-dibenzofuran
9-diazo-9aH-dibenzofuran (PubChem CID 118236164) has the molecular formula C12H8N2O
and a molecular weight of 196.21 g/mol. Its IUPAC name is 9-diazo-9aH-dibenzofuran.
Molecular Properties
| Compound Name | 9-diazo-9aH-dibenzofuran |
| PubChem CID | 118236164 |
| Molecular Formula | C12H8N2O |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.06 |
| IUPAC Name | 9-diazo-9aH-dibenzofuran |
| SMILES | [N-]=[N+]=C1C=CC=C2Oc3ccccc3C21 |
| InChI | InChI=1S/C12H8N2O/c13-14-9-5-3-7-11-12(9)8-4-1-2-6-10(8)15-11/h1-7,12H |
| InChIKey | WDPRWSQYSNZHOZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 45.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 9-diazo-9aH-dibenzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-diazo-9aH-dibenzofuran?
The IUPAC name of 9-diazo-9aH-dibenzofuran (CID 118236164) is 9-diazo-9aH-dibenzofuran.
What is the SMILES notation for 9-diazo-9aH-dibenzofuran?
The canonical SMILES for 9-diazo-9aH-dibenzofuran is [N-]=[N+]=C1C=CC=C2Oc3ccccc3C21.
What is the InChIKey of 9-diazo-9aH-dibenzofuran?
The InChIKey is WDPRWSQYSNZHOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O/c13-14-9-5-3-7-11-12(9)8-4-1-2-6-10(8)15-11/h1-7,12H.
What are the key properties of 9-diazo-9aH-dibenzofuran?
9-diazo-9aH-dibenzofuran has a molecular weight of 196.21 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 9-diazo-9aH-dibenzofuran is sourced from PubChem (CID 118236164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).