C23H23ClN4O6 — CID 118236315
ethyl 4-[4-[[2-chloro-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate (PubChem CID 118236315) has the molecular formula C23H23ClN4O6 and a molecular weight of 486.91 g/mol. Its IUPAC name is ethyl 4-[4-[[2-chloro-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate.
| Compound Name | ethyl 4-[4-[[2-chloro-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate |
|---|---|
| PubChem CID | 118236315 |
| Molecular Formula | C23H23ClN4O6 |
| Molecular Weight | 486.91 g/mol |
| Exact Mass | 486.13 |
| IUPAC Name | ethyl 4-[4-[[2-chloro-6-(4-methyl-5-oxotetrazol-1-yl)phenyl]methoxy]-3-methylphenyl]-3-methyl-2,4-dioxobutanoate |
| SMILES | CCOC(=O)C(=O)C(C)C(=O)c1ccc(OCc2c(Cl)cccc2-n2nnn(C)c2=O)c(C)c1 |
| InChI | InChI=1S/C23H23ClN4O6/c1-5-33-22(31)21(30)14(3)20(29)15-9-10-19(13(2)11-15)34-12-16-17(24)7-6-8-18(16)28-23(32)27(4)25-26-28/h6-11,14H,5,12H2,1-4H3 |
| InChIKey | KKSKBLKCWJABKM-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 122.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.91 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|