C17H14N4O — CID 118236704
(Z)-3-[4-(2-phenylethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enenitrile (PubChem CID 118236704) has the molecular formula C17H14N4O and a molecular weight of 290.33 g/mol. Its IUPAC name is (Z)-3-[4-(2-phenylethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enenitrile.
| Compound Name | (Z)-3-[4-(2-phenylethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 118236704 |
| Molecular Formula | C17H14N4O |
| Molecular Weight | 290.33 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | (Z)-3-[4-(2-phenylethoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-enenitrile |
| SMILES | N#C/C=C\c1c[nH]c2ncnc(OCCc3ccccc3)c12 |
| InChI | InChI=1S/C17H14N4O/c18-9-4-7-14-11-19-16-15(14)17(21-12-20-16)22-10-8-13-5-2-1-3-6-13/h1-7,11-12H,8,10H2,(H,19,20,21)/b7-4- |
| InChIKey | PLFRMQJDZOVTTK-DAXSKMNVSA-N |
| XLogP | 3.12 |
| TPSA | 74.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.33 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|