C14H16N4O2 — CID 118236876
4-(4-butan-2-yloxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl)but-2-ynamide (PubChem CID 118236876) has the molecular formula C14H16N4O2 and a molecular weight of 272.31 g/mol. Its IUPAC name is 4-(4-butan-2-yloxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl)but-2-ynamide.
| Compound Name | 4-(4-butan-2-yloxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl)but-2-ynamide |
|---|---|
| PubChem CID | 118236876 |
| Molecular Formula | C14H16N4O2 |
| Molecular Weight | 272.31 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 4-(4-butan-2-yloxy-7H-pyrrolo[2,3-d]pyrimidin-5-yl)but-2-ynamide |
| SMILES | CCC(C)Oc1ncnc2[nH]cc(CC#CC(N)=O)c12 |
| InChI | InChI=1S/C14H16N4O2/c1-3-9(2)20-14-12-10(5-4-6-11(15)19)7-16-13(12)17-8-18-14/h7-9H,3,5H2,1-2H3,(H2,15,19)(H,16,17,18) |
| InChIKey | QNJXDYKARDLBMP-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 93.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.31 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|