C14H18N4O3 — CID 118236948
(E)-4-hydroxy-N-[4-(2-methylpropoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enamide (PubChem CID 118236948) has the molecular formula C14H18N4O3 and a molecular weight of 290.32 g/mol. Its IUPAC name is (E)-4-hydroxy-N-[4-(2-methylpropoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enamide.
| Compound Name | (E)-4-hydroxy-N-[4-(2-methylpropoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enamide |
|---|---|
| PubChem CID | 118236948 |
| Molecular Formula | C14H18N4O3 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | (E)-4-hydroxy-N-[4-(2-methylpropoxy)-7H-pyrrolo[2,3-d]pyrimidin-5-yl]but-2-enamide |
| SMILES | CC(C)COc1ncnc2[nH]cc(NC(=O)/C=C/CO)c12 |
| InChI | InChI=1S/C14H18N4O3/c1-9(2)7-21-14-12-10(18-11(20)4-3-5-19)6-15-13(12)16-8-17-14/h3-4,6,8-9,19H,5,7H2,1-2H3,(H,18,20)(H,15,16,17)/b4-3+ |
| InChIKey | UUYMEXKXNYYBGB-ONEGZZNKSA-N |
| XLogP | 1.48 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|