C16H26O7 — CID 11823696
3-[(3aS,5S,6R,6aS)-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propyl 2,2-dimethylpropanoate (PubChem CID 11823696) has the molecular formula C16H26O7 and a molecular weight of 330.38 g/mol. Its IUPAC name is 3-[(3aS,5S,6R,6aS)-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propyl 2,2-dimethylpropanoate.
| Compound Name | 3-[(3aS,5S,6R,6aS)-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 11823696 |
| Molecular Formula | C16H26O7 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.17 |
| IUPAC Name | 3-[(3aS,5S,6R,6aS)-6-formyloxy-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]propyl 2,2-dimethylpropanoate |
| SMILES | CC1(C)O[C@@H]2O[C@@H](CCCOC(=O)C(C)(C)C)[C@@H](OC=O)[C@@H]2O1 |
| InChI | InChI=1S/C16H26O7/c1-15(2,3)14(18)19-8-6-7-10-11(20-9-17)12-13(21-10)23-16(4,5)22-12/h9-13H,6-8H2,1-5H3/t10-,11+,12-,13-/m0/s1 |
| InChIKey | CJVMWYLHVNMBIY-RNJOBUHISA-N |
| XLogP | 1.77 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|