C13H16ClN3O2 — CID 118237041
2-chloro-1-[4-[(2-methylpropan-2-yl)oxy]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propan-1-one (PubChem CID 118237041) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 2-chloro-1-[4-[(2-methylpropan-2-yl)oxy]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propan-1-one.
| Compound Name | 2-chloro-1-[4-[(2-methylpropan-2-yl)oxy]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propan-1-one |
|---|---|
| PubChem CID | 118237041 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 2-chloro-1-[4-[(2-methylpropan-2-yl)oxy]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]propan-1-one |
| SMILES | CC(Cl)C(=O)c1c[nH]c2ncnc(OC(C)(C)C)c12 |
| InChI | InChI=1S/C13H16ClN3O2/c1-7(14)10(18)8-5-15-11-9(8)12(17-6-16-11)19-13(2,3)4/h5-7H,1-4H3,(H,15,16,17) |
| InChIKey | CUXFPXBRQVIVMS-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|