C21H22F3N3O4 — CID 118237055
(2S)-3-amino-N-hydroxy-2-[4-[4-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-N-(2,2,2-trifluoroacetyl)anilino]-3-methylbutanamide (PubChem CID 118237055) has the molecular formula C21H22F3N3O4 and a molecular weight of 437.42 g/mol. Its IUPAC name is (2S)-3-amino-N-hydroxy-2-[4-[4-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-N-(2,2,2-trifluoroacetyl)anilino]-3-methylbutanamide.
| Compound Name | (2S)-3-amino-N-hydroxy-2-[4-[4-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-N-(2,2,2-trifluoroacetyl)anilino]-3-methylbutanamide |
|---|---|
| PubChem CID | 118237055 |
| Molecular Formula | C21H22F3N3O4 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | (2S)-3-amino-N-hydroxy-2-[4-[4-[(1R,2R)-2-(hydroxymethyl)cyclopropyl]buta-1,3-diynyl]-N-(2,2,2-trifluoroacetyl)anilino]-3-methylbutanamide |
| SMILES | CC(C)(N)[C@@H](C(=O)NO)N(C(=O)C(F)(F)F)c1ccc(C#CC#C[C@@H]2C[C@H]2CO)cc1 |
| InChI | InChI=1S/C21H22F3N3O4/c1-20(2,25)17(18(29)26-31)27(19(30)21(22,23)24)16-9-7-13(8-10-16)5-3-4-6-14-11-15(14)12-28/h7-10,14-15,17,28,31H,11-12,25H2,1-2H3,(H,26,29)/t14-,15+,17-/m1/s1 |
| InChIKey | APZOYPNRKLXEIO-HLLBOEOZSA-N |
| XLogP | 1.18 |
| TPSA | 115.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|