C15H11Cl2N3O2 — CID 118237191
2,7-dichloro-4-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidine (PubChem CID 118237191) has the molecular formula C15H11Cl2N3O2 and a molecular weight of 336.18 g/mol. Its IUPAC name is 2,7-dichloro-4-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidine.
| Compound Name | 2,7-dichloro-4-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 118237191 |
| Molecular Formula | C15H11Cl2N3O2 |
| Molecular Weight | 336.18 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | 2,7-dichloro-4-[3-(methoxymethoxy)phenyl]pyrido[3,2-d]pyrimidine |
| SMILES | COCOc1cccc(-c2nc(Cl)nc3cc(Cl)cnc23)c1 |
| InChI | InChI=1S/C15H11Cl2N3O2/c1-21-8-22-11-4-2-3-9(5-11)13-14-12(19-15(17)20-13)6-10(16)7-18-14/h2-7H,8H2,1H3 |
| InChIKey | KJABYEHKJGKYLT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 57.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.18 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|