C21H24N4O5 — CID 118237194
1-[2-[3-(methoxymethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl]ethane-1,2-diol (PubChem CID 118237194) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 1-[2-[3-(methoxymethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl]ethane-1,2-diol.
| Compound Name | 1-[2-[3-(methoxymethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 118237194 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 1-[2-[3-(methoxymethoxy)phenyl]-4-morpholin-4-ylpyrido[3,2-d]pyrimidin-7-yl]ethane-1,2-diol |
| SMILES | COCOc1cccc(-c2nc(N3CCOCC3)c3ncc(C(O)CO)cc3n2)c1 |
| InChI | InChI=1S/C21H24N4O5/c1-28-13-30-16-4-2-3-14(9-16)20-23-17-10-15(18(27)12-26)11-22-19(17)21(24-20)25-5-7-29-8-6-25/h2-4,9-11,18,26-27H,5-8,12-13H2,1H3 |
| InChIKey | PSYFIZDAOLSCOD-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 110.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|