C25H26F2N4O4 — CID 118237425
(4R)-7-(difluoromethoxy)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-methoxy-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide (PubChem CID 118237425) has the molecular formula C25H26F2N4O4 and a molecular weight of 484.50 g/mol. Its IUPAC name is (4R)-7-(difluoromethoxy)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-methoxy-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide.
| Compound Name | (4R)-7-(difluoromethoxy)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-methoxy-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
|---|---|
| PubChem CID | 118237425 |
| Molecular Formula | C25H26F2N4O4 |
| Molecular Weight | 484.50 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (4R)-7-(difluoromethoxy)-1-[4-(3,5-dimethyl-1,2-oxazol-4-yl)phenyl]-8-methoxy-N,4-dimethyl-4,5-dihydro-2,3-benzodiazepine-3-carboxamide |
| SMILES | CNC(=O)N1N=C(c2ccc(-c3c(C)noc3C)cc2)c2cc(OC)c(OC(F)F)cc2C[C@H]1C |
| InChI | InChI=1S/C25H26F2N4O4/c1-13-10-18-11-21(34-24(26)27)20(33-5)12-19(18)23(29-31(13)25(32)28-4)17-8-6-16(7-9-17)22-14(2)30-35-15(22)3/h6-9,11-13,24H,10H2,1-5H3,(H,28,32)/t13-/m1/s1 |
| InChIKey | QQENNSOEIIPWGC-CYBMUJFWSA-N |
| XLogP | 4.91 |
| TPSA | 89.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |