About 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine
5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine (PubChem CID 118238019) has the molecular formula C8H10BrClN2
and a molecular weight of 249.54 g/mol. Its IUPAC name is 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine.
Molecular Properties
| Compound Name | 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine |
| PubChem CID | 118238019 |
| Molecular Formula | C8H10BrClN2 |
| Molecular Weight | 249.54 g/mol |
| Exact Mass | 247.97 |
| IUPAC Name | 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine |
| SMILES | Cc1c(Br)cnc(Cl)c1N(C)C |
| InChI | InChI=1S/C8H10BrClN2/c1-5-6(9)4-11-8(10)7(5)12(2)3/h4H,1-3H3 |
| InChIKey | OFNFMYJGOVNOJM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.54 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine?
The IUPAC name of 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine (CID 118238019) is 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine.
What is the SMILES notation for 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine?
The canonical SMILES for 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine is Cc1c(Br)cnc(Cl)c1N(C)C.
What is the InChIKey of 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine?
The InChIKey is OFNFMYJGOVNOJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BrClN2/c1-5-6(9)4-11-8(10)7(5)12(2)3/h4H,1-3H3.
What are the key properties of 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine?
5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine has a molecular weight of 249.54 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-2-chloro-N,N,4-trimethylpyridin-3-amine is sourced from PubChem (CID 118238019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).