C26H22F3N5O2 — CID 118238123
N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine (PubChem CID 118238123) has the molecular formula C26H22F3N5O2 and a molecular weight of 493.49 g/mol. Its IUPAC name is N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine.
| Compound Name | N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
|---|---|
| PubChem CID | 118238123 |
| Molecular Formula | C26H22F3N5O2 |
| Molecular Weight | 493.49 g/mol |
| Exact Mass | 493.17 |
| IUPAC Name | N-[3-methoxy-4-(2-methyl-4-pyridinyl)phenyl]-8-methyl-7-(3,4,5-trifluorophenyl)-6,7-dihydropyrimido[5,4-b][1,4]oxazin-2-amine |
| SMILES | COc1cc(Nc2ncc3c(n2)N(C)C(c2cc(F)c(F)c(F)c2)CO3)ccc1-c1ccnc(C)c1 |
| InChI | InChI=1S/C26H22F3N5O2/c1-14-8-15(6-7-30-14)18-5-4-17(11-22(18)35-3)32-26-31-12-23-25(33-26)34(2)21(13-36-23)16-9-19(27)24(29)20(28)10-16/h4-12,21H,13H2,1-3H3,(H,31,32,33) |
| InChIKey | UFVDYBRLXDXGRG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.49 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|