C13H16F6O3 — CID 11823822
1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(R)-cyclohexyl(hydroxy)methyl]prop-2-enoate (PubChem CID 11823822) has the molecular formula C13H16F6O3 and a molecular weight of 334.26 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(R)-cyclohexyl(hydroxy)methyl]prop-2-enoate.
| Compound Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(R)-cyclohexyl(hydroxy)methyl]prop-2-enoate |
|---|---|
| PubChem CID | 11823822 |
| Molecular Formula | C13H16F6O3 |
| Molecular Weight | 334.26 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoropropan-2-yl 2-[(R)-cyclohexyl(hydroxy)methyl]prop-2-enoate |
| SMILES | C=C(C(=O)OC(C(F)(F)F)C(F)(F)F)[C@H](O)C1CCCCC1 |
| InChI | InChI=1S/C13H16F6O3/c1-7(9(20)8-5-3-2-4-6-8)10(21)22-11(12(14,15)16)13(17,18)19/h8-9,11,20H,1-6H2/t9-/m0/s1 |
| InChIKey | JESWWSGLXSNRQH-VIFPVBQESA-N |
| XLogP | 3.52 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|