C14H13ClF3N3O4S — CID 118238259
2-[2-chloro-4-(methylamino)pyrimidin-5-yl]oxyethyl (2,4,5-trifluorophenyl)methanesulfonate (PubChem CID 118238259) has the molecular formula C14H13ClF3N3O4S and a molecular weight of 411.79 g/mol. Its IUPAC name is 2-[2-chloro-4-(methylamino)pyrimidin-5-yl]oxyethyl (2,4,5-trifluorophenyl)methanesulfonate.
| Compound Name | 2-[2-chloro-4-(methylamino)pyrimidin-5-yl]oxyethyl (2,4,5-trifluorophenyl)methanesulfonate |
|---|---|
| PubChem CID | 118238259 |
| Molecular Formula | C14H13ClF3N3O4S |
| Molecular Weight | 411.79 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | 2-[2-chloro-4-(methylamino)pyrimidin-5-yl]oxyethyl (2,4,5-trifluorophenyl)methanesulfonate |
| SMILES | CNc1nc(Cl)ncc1OCCOS(=O)(=O)Cc1cc(F)c(F)cc1F |
| InChI | InChI=1S/C14H13ClF3N3O4S/c1-19-13-12(6-20-14(15)21-13)24-2-3-25-26(22,23)7-8-4-10(17)11(18)5-9(8)16/h4-6H,2-3,7H2,1H3,(H,19,20,21) |
| InChIKey | ITDPSEHMCNAJCP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.79 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|